C18H26BCl2NO4 — CID 145395433
cis-(1S,5R)-5-(2-boronoethyl)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 145395433) has the molecular formula C18H26BCl2NO4 and a molecular weight of 402.13 g/mol. Its IUPAC name is cis-(1S,5R)-5-(2-boronoethyl)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,5R)-5-(2-boronoethyl)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145395433 |
| Molecular Formula | C18H26BCl2NO4 |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | cis-(1S,5R)-5-(2-boronoethyl)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)CC1CC[C@@H](CCB(O)O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H26BCl2NO4/c1-22(10-13-3-5-16(20)17(21)9-13)11-14-4-2-12(6-7-19(25)26)8-15(14)18(23)24/h3,5,9,12,14-15,25-26H,2,4,6-8,10-11H2,1H3,(H,23,24)/t12-,14?,15-/m0/s1 |
| InChIKey | KSCZERBYGYKTDV-JDLVMGNASA-N |
| XLogP | 3.41 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|