C18H26BNO4 — CID 147196734
cis-(1S,5R)-5-(2-boronoethyl)-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 147196734) has the molecular formula C18H26BNO4 and a molecular weight of 331.22 g/mol. Its IUPAC name is cis-(1S,5R)-5-(2-boronoethyl)-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,5R)-5-(2-boronoethyl)-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 147196734 |
| Molecular Formula | C18H26BNO4 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | cis-(1S,5R)-5-(2-boronoethyl)-2-(1,3-dihydroisoindol-2-ylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H](CCB(O)O)CCC1CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H26BNO4/c21-18(22)17-9-13(7-8-19(23)24)5-6-16(17)12-20-10-14-3-1-2-4-15(14)11-20/h1-4,13,16-17,23-24H,5-12H2,(H,21,22)/t13-,16?,17-/m0/s1 |
| InChIKey | CCNGDAPWVKOLMQ-KAKCIXEOSA-N |
| XLogP | 1.98 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|