C10H22BNO5 — CID 145395566
acetic acid;2-[(1R,3S,4S)-3-amino-4-hydroxycyclohexyl]ethylboronic acid (PubChem CID 145395566) has the molecular formula C10H22BNO5 and a molecular weight of 247.10 g/mol. Its IUPAC name is acetic acid;2-[(1R,3S,4S)-3-amino-4-hydroxycyclohexyl]ethylboronic acid.
| Compound Name | acetic acid;2-[(1R,3S,4S)-3-amino-4-hydroxycyclohexyl]ethylboronic acid |
|---|---|
| PubChem CID | 145395566 |
| Molecular Formula | C10H22BNO5 |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | acetic acid;2-[(1R,3S,4S)-3-amino-4-hydroxycyclohexyl]ethylboronic acid |
| SMILES | CC(=O)O.N[C@H]1C[C@H](CCB(O)O)CC[C@@H]1O |
| InChI | InChI=1S/C8H18BNO3.C2H4O2/c10-7-5-6(1-2-8(7)11)3-4-9(12)13;1-2(3)4/h6-8,11-13H,1-5,10H2;1H3,(H,3,4)/t6-,7-,8-;/m0./s1 |
| InChIKey | ATBNAWUSUWCBBQ-WQYNNSOESA-N |
| XLogP | -0.57 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|