C14H28BNO4 — CID 148889002
(1S)-5-(2-boronoethyl)-2-[[methyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 148889002) has the molecular formula C14H28BNO4 and a molecular weight of 285.19 g/mol. Its IUPAC name is (1S)-5-(2-boronoethyl)-2-[[methyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | (1S)-5-(2-boronoethyl)-2-[[methyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 148889002 |
| Molecular Formula | C14H28BNO4 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (1S)-5-(2-boronoethyl)-2-[[methyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)N(C)CC1CCC(CCB(O)O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C14H28BNO4/c1-10(2)16(3)9-12-5-4-11(6-7-15(19)20)8-13(12)14(17)18/h10-13,19-20H,4-9H2,1-3H3,(H,17,18)/t11?,12?,13-/m0/s1 |
| InChIKey | PENSERYMMNADAP-BPCQOVAHSA-N |
| XLogP | 1.31 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|