C12H24BNO4 — CID 148782911
trans-(1S,2R)-5-(2-boronoethyl)-2-[(dimethylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 148782911) has the molecular formula C12H24BNO4 and a molecular weight of 257.14 g/mol. Its IUPAC name is trans-(1S,2R)-5-(2-boronoethyl)-2-[(dimethylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-5-(2-boronoethyl)-2-[(dimethylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 148782911 |
| Molecular Formula | C12H24BNO4 |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | trans-(1S,2R)-5-(2-boronoethyl)-2-[(dimethylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(C)C[C@@H]1CCC(CCB(O)O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H24BNO4/c1-14(2)8-10-4-3-9(5-6-13(17)18)7-11(10)12(15)16/h9-11,17-18H,3-8H2,1-2H3,(H,15,16)/t9?,10-,11-/m0/s1 |
| InChIKey | OKQSXQOJKUCEEY-DVRYWGNFSA-N |
| XLogP | 0.53 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|