C17H18FN5O — CID 145397875
5-[(Z)-4-(2-cyano-4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-2-carboxamide;ethane (PubChem CID 145397875) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 5-[(Z)-4-(2-cyano-4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-2-carboxamide;ethane.
| Compound Name | 5-[(Z)-4-(2-cyano-4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 145397875 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 5-[(Z)-4-(2-cyano-4-fluorophenyl)-4-iminobut-2-en-2-yl]-1H-imidazole-2-carboxamide;ethane |
| SMILES | CC.[H]/N=C(/C=C(/C)c1cnc(C(N)=O)[nH]1)c1ccc(F)cc1C#N |
| InChI | InChI=1S/C15H12FN5O.C2H6/c1-8(13-7-20-15(21-13)14(19)22)4-12(18)11-3-2-10(16)5-9(11)6-17;1-2/h2-5,7,18H,1H3,(H2,19,22)(H,20,21);1-2H3/b8-4-,18-12-; |
| InChIKey | OWCXOYXIESYKOI-YAEJUDRFSA-N |
| XLogP | 3.02 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|