C31H40ClF4N3O5 — CID 145399377
tert-butyl 3-[[1-(2-tert-butyl-4-chloroanilino)piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 145399377) has the molecular formula C31H40ClF4N3O5 and a molecular weight of 646.12 g/mol. Its IUPAC name is tert-butyl 3-[[1-(2-tert-butyl-4-chloroanilino)piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[[1-(2-tert-butyl-4-chloroanilino)piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 145399377 |
| Molecular Formula | C31H40ClF4N3O5 |
| Molecular Weight | 646.12 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | tert-butyl 3-[[1-(2-tert-butyl-4-chloroanilino)piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)C1CCN(Nc2ccc(Cl)cc2C(C)(C)C)CC1)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C31H40ClF4N3O5/c1-30(2,3)19-13-18(32)7-8-22(19)38-39-11-9-17(10-12-39)29(42)37-23(15-25(41)44-31(4,5)6)24(40)16-43-28-26(35)20(33)14-21(34)27(28)36/h7-8,13-14,17,23-24,38,40H,9-12,15-16H2,1-6H3,(H,37,42) |
| InChIKey | KIURIUSHDXFVGQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.12 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|