C29H27N — CID 145412765
3-[9-(3-ethenylpenta-2,4-dien-2-yl)-9-prop-1-en-2-ylfluoren-2-yl]aniline (PubChem CID 145412765) has the molecular formula C29H27N and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[9-(3-ethenylpenta-2,4-dien-2-yl)-9-prop-1-en-2-ylfluoren-2-yl]aniline.
| Compound Name | 3-[9-(3-ethenylpenta-2,4-dien-2-yl)-9-prop-1-en-2-ylfluoren-2-yl]aniline |
|---|---|
| PubChem CID | 145412765 |
| Molecular Formula | C29H27N |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 3-[9-(3-ethenylpenta-2,4-dien-2-yl)-9-prop-1-en-2-ylfluoren-2-yl]aniline |
| SMILES | C=CC(C=C)=C(C)C1(C(=C)C)c2ccccc2-c2ccc(-c3cccc(N)c3)cc21 |
| InChI | InChI=1S/C29H27N/c1-6-21(7-2)20(5)29(19(3)4)27-14-9-8-13-25(27)26-16-15-23(18-28(26)29)22-11-10-12-24(30)17-22/h6-18H,1-3,30H2,4-5H3 |
| InChIKey | SKWAGSZUNNDRFB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|