C48H42 — CID 145412837
2-[3-[3-[cyclohexa-1,3-dien-1-yl(phenyl)methyl]phenyl]phenyl]-9,9-bis[(2Z)-penta-2,4-dien-2-yl]fluorene (PubChem CID 145412837) has the molecular formula C48H42 and a molecular weight of 618.86 g/mol. Its IUPAC name is 2-[3-[3-[cyclohexa-1,3-dien-1-yl(phenyl)methyl]phenyl]phenyl]-9,9-bis[(2Z)-penta-2,4-dien-2-yl]fluorene.
| Compound Name | 2-[3-[3-[cyclohexa-1,3-dien-1-yl(phenyl)methyl]phenyl]phenyl]-9,9-bis[(2Z)-penta-2,4-dien-2-yl]fluorene |
|---|---|
| PubChem CID | 145412837 |
| Molecular Formula | C48H42 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 2-[3-[3-[cyclohexa-1,3-dien-1-yl(phenyl)methyl]phenyl]phenyl]-9,9-bis[(2Z)-penta-2,4-dien-2-yl]fluorene |
| SMILES | C=C/C=C(/C)C1(/C(C)=C\C=C)c2ccccc2-c2ccc(-c3cccc(-c4cccc(C(C5=CC=CCC5)c5ccccc5)c4)c3)cc21 |
| InChI | InChI=1S/C48H42/c1-5-17-34(3)48(35(4)18-6-2)45-28-14-13-27-43(45)44-30-29-41(33-46(44)48)39-24-15-23-38(31-39)40-25-16-26-42(32-40)47(36-19-9-7-10-20-36)37-21-11-8-12-22-37/h5-11,13-21,23-33,47H,1-2,12,22H2,3-4H3/b34-17-,35-18- |
| InChIKey | PRKKIZJYFXTDBX-LYZYYCFWSA-N |
| XLogP | 12.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|