C17H18Cl2N6O — CID 145413202
9-(3,5-dichlorophenyl)-2-N-(4-methyloxan-4-yl)purine-2,8-diamine (PubChem CID 145413202) has the molecular formula C17H18Cl2N6O and a molecular weight of 393.28 g/mol. Its IUPAC name is 9-(3,5-dichlorophenyl)-2-N-(4-methyloxan-4-yl)purine-2,8-diamine.
| Compound Name | 9-(3,5-dichlorophenyl)-2-N-(4-methyloxan-4-yl)purine-2,8-diamine |
|---|---|
| PubChem CID | 145413202 |
| Molecular Formula | C17H18Cl2N6O |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 9-(3,5-dichlorophenyl)-2-N-(4-methyloxan-4-yl)purine-2,8-diamine |
| SMILES | CC1(Nc2ncc3nc(N)n(-c4cc(Cl)cc(Cl)c4)c3n2)CCOCC1 |
| InChI | InChI=1S/C17H18Cl2N6O/c1-17(2-4-26-5-3-17)24-16-21-9-13-14(23-16)25(15(20)22-13)12-7-10(18)6-11(19)8-12/h6-9H,2-5H2,1H3,(H2,20,22)(H,21,23,24) |
| InChIKey | PVCRALULVFEWJM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |