C19H30N10 — CID 144695467
2-N,9-bis(1-ethylpyrazol-4-yl)purine-2,8-diamine;ethane (PubChem CID 144695467) has the molecular formula C19H30N10 and a molecular weight of 398.52 g/mol. Its IUPAC name is 2-N,9-bis(1-ethylpyrazol-4-yl)purine-2,8-diamine;ethane.
| Compound Name | 2-N,9-bis(1-ethylpyrazol-4-yl)purine-2,8-diamine;ethane |
|---|---|
| PubChem CID | 144695467 |
| Molecular Formula | C19H30N10 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-N,9-bis(1-ethylpyrazol-4-yl)purine-2,8-diamine;ethane |
| SMILES | CC.CC.CCn1cc(Nc2ncc3nc(N)n(-c4cnn(CC)c4)c3n2)cn1 |
| InChI | InChI=1S/C15H18N10.2C2H6/c1-3-23-8-10(5-18-23)20-15-17-7-12-13(22-15)25(14(16)21-12)11-6-19-24(4-2)9-11;2*1-2/h5-9H,3-4H2,1-2H3,(H2,16,21)(H,17,20,22);2*1-2H3 |
| InChIKey | DFOCCDDYJOXJLK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |