C14H18N10 — CID 123527628
3-(1-ethylimino-3-iminopropan-2-yl)-N-(1-ethylpyrazol-4-yl)triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 123527628) has the molecular formula C14H18N10 and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-(1-ethylimino-3-iminopropan-2-yl)-N-(1-ethylpyrazol-4-yl)triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 3-(1-ethylimino-3-iminopropan-2-yl)-N-(1-ethylpyrazol-4-yl)triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 123527628 |
| Molecular Formula | C14H18N10 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-(1-ethylimino-3-iminopropan-2-yl)-N-(1-ethylpyrazol-4-yl)triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | [H]/N=C/C(/C=N/CC)n1nnc2cnc(Nc3cnn(CC)c3)nc21 |
| InChI | InChI=1S/C14H18N10/c1-3-16-7-11(5-15)24-13-12(21-22-24)8-17-14(20-13)19-10-6-18-23(4-2)9-10/h5-9,11,15H,3-4H2,1-2H3,(H,17,19,20)/b15-5+,16-7+ |
| InChIKey | MQXOYQUVWIIMCI-IAQKOEEMSA-N |
| XLogP | 1.46 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|