C22H26N4O4 — CID 145437481
2-(2-but-3-enoxypyrimidin-4-yl)-N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]benzamide (PubChem CID 145437481) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-(2-but-3-enoxypyrimidin-4-yl)-N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]benzamide.
| Compound Name | 2-(2-but-3-enoxypyrimidin-4-yl)-N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]benzamide |
|---|---|
| PubChem CID | 145437481 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-(2-but-3-enoxypyrimidin-4-yl)-N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]benzamide |
| SMILES | C=CCCOc1nccc(-c2ccccc2C(=O)NC(CC=C)C(=O)N(C)OC)n1 |
| InChI | InChI=1S/C22H26N4O4/c1-5-7-15-30-22-23-14-13-18(25-22)16-11-8-9-12-17(16)20(27)24-19(10-6-2)21(28)26(3)29-4/h5-6,8-9,11-14,19H,1-2,7,10,15H2,3-4H3,(H,24,27) |
| InChIKey | SGADQBGHQTWHON-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|