C23H32N2O4 — CID 145437702
N-[1-[methoxy(methyl)amino]-1-oxobutan-2-yl]-2-[(2E,4E)-4-propoxyhepta-2,4,6-trien-2-yl]benzamide (PubChem CID 145437702) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[1-[methoxy(methyl)amino]-1-oxobutan-2-yl]-2-[(2E,4E)-4-propoxyhepta-2,4,6-trien-2-yl]benzamide.
| Compound Name | N-[1-[methoxy(methyl)amino]-1-oxobutan-2-yl]-2-[(2E,4E)-4-propoxyhepta-2,4,6-trien-2-yl]benzamide |
|---|---|
| PubChem CID | 145437702 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[1-[methoxy(methyl)amino]-1-oxobutan-2-yl]-2-[(2E,4E)-4-propoxyhepta-2,4,6-trien-2-yl]benzamide |
| SMILES | C=C/C=C(\C=C(/C)c1ccccc1C(=O)NC(CC)C(=O)N(C)OC)OCCC |
| InChI | InChI=1S/C23H32N2O4/c1-7-12-18(29-15-8-2)16-17(4)19-13-10-11-14-20(19)22(26)24-21(9-3)23(27)25(5)28-6/h7,10-14,16,21H,1,8-9,15H2,2-6H3,(H,24,26)/b17-16+,18-12+ |
| InChIKey | NKTZWFUUOHDGNQ-QKOXZUTBSA-N |
| XLogP | 4.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|