C21H29NO4 — CID 145438173
ethyl (3S,4S)-1-[[2-[(E)-4-ethoxy-4-oxobut-2-enyl]phenyl]methyl]-4-methylpyrrolidine-3-carboxylate (PubChem CID 145438173) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl (3S,4S)-1-[[2-[(E)-4-ethoxy-4-oxobut-2-enyl]phenyl]methyl]-4-methylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-[[2-[(E)-4-ethoxy-4-oxobut-2-enyl]phenyl]methyl]-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 145438173 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl (3S,4S)-1-[[2-[(E)-4-ethoxy-4-oxobut-2-enyl]phenyl]methyl]-4-methylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)/C=C/Cc1ccccc1CN1C[C@@H](C)[C@H](C(=O)OCC)C1 |
| InChI | InChI=1S/C21H29NO4/c1-4-25-20(23)12-8-11-17-9-6-7-10-18(17)14-22-13-16(3)19(15-22)21(24)26-5-2/h6-10,12,16,19H,4-5,11,13-15H2,1-3H3/b12-8+/t16-,19-/m1/s1 |
| InChIKey | JALJPZSSJJEODK-BTORSOPLSA-N |
| XLogP | 2.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|