C18H14F3NO3S — CID 145440528
(2-cyclohexa-1,5-dien-1-yl-4-pyridin-2-ylphenyl) trifluoromethanesulfonate (PubChem CID 145440528) has the molecular formula C18H14F3NO3S and a molecular weight of 381.38 g/mol. Its IUPAC name is (2-cyclohexa-1,5-dien-1-yl-4-pyridin-2-ylphenyl) trifluoromethanesulfonate.
| Compound Name | (2-cyclohexa-1,5-dien-1-yl-4-pyridin-2-ylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145440528 |
| Molecular Formula | C18H14F3NO3S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (2-cyclohexa-1,5-dien-1-yl-4-pyridin-2-ylphenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccccn2)cc1C1=CCCC=C1)C(F)(F)F |
| InChI | InChI=1S/C18H14F3NO3S/c19-18(20,21)26(23,24)25-17-10-9-14(16-8-4-5-11-22-16)12-15(17)13-6-2-1-3-7-13/h2,4-12H,1,3H2 |
| InChIKey | ZPCZTMWEXMXOMA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|