C19H25N — CID 145444914
(5Z,7Z)-2,9,10,10-tetramethyl-2-azabicyclo[9.4.1]hexadeca-1(16),5,7,11(16),12,14-hexaene (PubChem CID 145444914) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (5Z,7Z)-2,9,10,10-tetramethyl-2-azabicyclo[9.4.1]hexadeca-1(16),5,7,11(16),12,14-hexaene.
| Compound Name | (5Z,7Z)-2,9,10,10-tetramethyl-2-azabicyclo[9.4.1]hexadeca-1(16),5,7,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 145444914 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (5Z,7Z)-2,9,10,10-tetramethyl-2-azabicyclo[9.4.1]hexadeca-1(16),5,7,11(16),12,14-hexaene |
| SMILES | CC1/C=C\C=C/CCN(C)C2=C=C(C=CC=C2)C1(C)C |
| InChI | InChI=1S/C19H25N/c1-16-11-7-5-6-10-14-20(4)18-13-9-8-12-17(15-18)19(16,2)3/h5-9,11-13,16H,10,14H2,1-4H3/b6-5-,11-7- |
| InChIKey | AHONESADJGPZEA-FUVGTJSASA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |