C21H25NO3 — CID 145453284
2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium (PubChem CID 145453284) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium.
| Compound Name | 2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 145453284 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-1-methyl-1-oxidopiperidin-1-ium |
| SMILES | C[N+]1([O-])CCCCC1[C@H]1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H25NO3/c1-22(23)15-9-8-14-19(22)20-16-24-21(25-20,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,19-20H,8-9,14-16H2,1H3/t19?,20-,22?/m1/s1 |
| InChIKey | QBYZAYIDDMUFDF-SNCIUUNGSA-N |
| XLogP | 3.80 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|