C20H14Cl2O — CID 145471111
[4-(3,5-dichlorophenyl)-3-methylphenyl]-phenylmethanone (PubChem CID 145471111) has the molecular formula C20H14Cl2O and a molecular weight of 341.24 g/mol. Its IUPAC name is [4-(3,5-dichlorophenyl)-3-methylphenyl]-phenylmethanone.
| Compound Name | [4-(3,5-dichlorophenyl)-3-methylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 145471111 |
| Molecular Formula | C20H14Cl2O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [4-(3,5-dichlorophenyl)-3-methylphenyl]-phenylmethanone |
| SMILES | Cc1cc(C(=O)c2ccccc2)ccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2O/c1-13-9-15(20(23)14-5-3-2-4-6-14)7-8-19(13)16-10-17(21)12-18(22)11-16/h2-12H,1H3 |
| InChIKey | UGQARUJJHIPMKQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |