C20H27N3OS — CID 145471371
N-[[3-[2-methoxyethyl(methyl)amino]sulfanylphenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 145471371) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[[3-[2-methoxyethyl(methyl)amino]sulfanylphenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-[[3-[2-methoxyethyl(methyl)amino]sulfanylphenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 145471371 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[[3-[2-methoxyethyl(methyl)amino]sulfanylphenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | COCCN(C)Sc1cccc(CNC2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C20H27N3OS/c1-23(12-13-24-2)25-18-9-3-6-16(14-18)15-22-19-10-4-7-17-8-5-11-21-20(17)19/h3,5-6,8-9,11,14,19,22H,4,7,10,12-13,15H2,1-2H3 |
| InChIKey | QHVWHCVBHUEVJS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|