C28H30FN5O2 — CID 145473979
6-[4-[4-[(2-fluorophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbaldehyde;methoxyethane (PubChem CID 145473979) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is 6-[4-[4-[(2-fluorophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbaldehyde;methoxyethane.
| Compound Name | 6-[4-[4-[(2-fluorophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 145473979 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 6-[4-[4-[(2-fluorophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbaldehyde;methoxyethane |
| SMILES | CCOC.O=Cc1ccc(N2CCN(c3nnc(Cc4ccccc4F)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C25H22FN5O.C3H8O/c26-22-8-4-1-5-19(22)15-23-20-6-2-3-7-21(20)25(29-28-23)31-13-11-30(12-14-31)24-10-9-18(17-32)16-27-24;1-3-4-2/h1-10,16-17H,11-15H2;3H2,1-2H3 |
| InChIKey | FVIRIAQBPSFHMY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|