About [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate
[4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate (PubChem CID 145474059) has the molecular formula C18H19F3O2S2
and a molecular weight of 388.48 g/mol. Its IUPAC name is [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate |
| PubChem CID | 145474059 |
| Molecular Formula | C18H19F3O2S2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)OCC(CCc2ccccc2)SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3O2S2/c1-14-7-11-17(12-8-14)25(22)23-13-16(24-18(19,20)21)10-9-15-5-3-2-4-6-15/h2-8,11-12,16H,9-10,13H2,1H3 |
| InChIKey | YDOFNGDPHXHMAZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate?
The IUPAC name of [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate (CID 145474059) is [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate.
What is the SMILES notation for [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate?
The canonical SMILES for [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate is Cc1ccc(S(=O)OCC(CCc2ccccc2)SC(F)(F)F)cc1.
What is the InChIKey of [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate?
The InChIKey is YDOFNGDPHXHMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3O2S2/c1-14-7-11-17(12-8-14)25(22)23-13-16(24-18(19,20)21)10-9-15-5-3-2-4-6-15/h2-8,11-12,16H,9-10,13H2,1H3.
What are the key properties of [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate?
[4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate has a molecular weight of 388.48 g/mol, XLogP of 5.29, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-phenyl-2-(trifluoromethylsulfanyl)butyl] 4-methylbenzenesulfinate is sourced from PubChem (CID 145474059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).