C12H11N5O2S2 — CID 145474125
3-(5-cyano-4-hydrazinyl-6-methylsulfanylpyrimidin-2-yl)benzenesulfinic acid (PubChem CID 145474125) has the molecular formula C12H11N5O2S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-(5-cyano-4-hydrazinyl-6-methylsulfanylpyrimidin-2-yl)benzenesulfinic acid.
| Compound Name | 3-(5-cyano-4-hydrazinyl-6-methylsulfanylpyrimidin-2-yl)benzenesulfinic acid |
|---|---|
| PubChem CID | 145474125 |
| Molecular Formula | C12H11N5O2S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-(5-cyano-4-hydrazinyl-6-methylsulfanylpyrimidin-2-yl)benzenesulfinic acid |
| SMILES | CSc1nc(-c2cccc(S(=O)O)c2)nc(NN)c1C#N |
| InChI | InChI=1S/C12H11N5O2S2/c1-20-12-9(6-13)11(17-14)15-10(16-12)7-3-2-4-8(5-7)21(18)19/h2-5H,14H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | KTKXXFXBXHUXLO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|