C26H39N2O2P — CID 145493317
N-[(1E,3E)-6-[6-(2-diethoxyphosphanylethylamino)cyclohexa-1,5-dien-1-yl]-6-methylhepta-1,3-dienyl]aniline (PubChem CID 145493317) has the molecular formula C26H39N2O2P and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[(1E,3E)-6-[6-(2-diethoxyphosphanylethylamino)cyclohexa-1,5-dien-1-yl]-6-methylhepta-1,3-dienyl]aniline.
| Compound Name | N-[(1E,3E)-6-[6-(2-diethoxyphosphanylethylamino)cyclohexa-1,5-dien-1-yl]-6-methylhepta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 145493317 |
| Molecular Formula | C26H39N2O2P |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-[(1E,3E)-6-[6-(2-diethoxyphosphanylethylamino)cyclohexa-1,5-dien-1-yl]-6-methylhepta-1,3-dienyl]aniline |
| SMILES | CCOP(CCNC1=CCCC=C1C(C)(C)C/C=C/C=C/Nc1ccccc1)OCC |
| InChI | InChI=1S/C26H39N2O2P/c1-5-29-31(30-6-2)22-21-28-25-18-12-11-17-24(25)26(3,4)19-13-8-14-20-27-23-15-9-7-10-16-23/h7-10,13-18,20,27-28H,5-6,11-12,19,21-22H2,1-4H3/b13-8+,20-14+ |
| InChIKey | QLAIQEUEKYXDKY-PMMWVYMGSA-N |
| XLogP | 7.16 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|