C16H17BrF3N5O5 — CID 145496961
2-[amino-[(Z)-[amino-[3-[3-[2-bromo-5-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]methylidene]amino]amino]acetic acid (PubChem CID 145496961) has the molecular formula C16H17BrF3N5O5 and a molecular weight of 496.24 g/mol. Its IUPAC name is 2-[amino-[(Z)-[amino-[3-[3-[2-bromo-5-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]methylidene]amino]amino]acetic acid.
| Compound Name | 2-[amino-[(Z)-[amino-[3-[3-[2-bromo-5-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]methylidene]amino]amino]acetic acid |
|---|---|
| PubChem CID | 145496961 |
| Molecular Formula | C16H17BrF3N5O5 |
| Molecular Weight | 496.24 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 2-[amino-[(Z)-[amino-[3-[3-[2-bromo-5-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]methylidene]amino]amino]acetic acid |
| SMILES | N/C(=N\N(N)CC(=O)O)c1cc(OCCCOc2cc(C(F)(F)F)ccc2Br)no1 |
| InChI | InChI=1S/C16H17BrF3N5O5/c17-10-3-2-9(16(18,19)20)6-11(10)28-4-1-5-29-13-7-12(30-24-13)15(21)23-25(22)8-14(26)27/h2-3,6-7H,1,4-5,8,22H2,(H2,21,23)(H,26,27) |
| InChIKey | JPKQRIZJQLOCKR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|