C25H40N4O3 — CID 145498861
6-cyclopropyl-7,22-diethyl-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione (PubChem CID 145498861) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is 6-cyclopropyl-7,22-diethyl-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione.
| Compound Name | 6-cyclopropyl-7,22-diethyl-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione |
|---|---|
| PubChem CID | 145498861 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 6-cyclopropyl-7,22-diethyl-8-methyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-10,13-dione |
| SMILES | CCc1cccc2c1OCCNC(C1CC1)C(CC)N(C)CC(=O)NCC(=O)NCCC2 |
| InChI | InChI=1S/C25H40N4O3/c1-4-18-8-6-9-20-10-7-13-26-22(30)16-28-23(31)17-29(3)21(5-2)24(19-11-12-19)27-14-15-32-25(18)20/h6,8-9,19,21,24,27H,4-5,7,10-17H2,1-3H3,(H,26,30)(H,28,31) |
| InChIKey | LVICZZAGJOVMCZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |