C34H58N4O2 — CID 145499039
(12E)-13-cyclopropyl-11,16-dimethyl-23-propyl-12-propylidene-5,8,11,14-tetrazabicyclo[17.3.1]tricosa-1(23),19,21-triene-6,9-dione;2-methylpropane (PubChem CID 145499039) has the molecular formula C34H58N4O2 and a molecular weight of 554.86 g/mol. Its IUPAC name is (12E)-13-cyclopropyl-11,16-dimethyl-23-propyl-12-propylidene-5,8,11,14-tetrazabicyclo[17.3.1]tricosa-1(23),19,21-triene-6,9-dione;2-methylpropane.
| Compound Name | (12E)-13-cyclopropyl-11,16-dimethyl-23-propyl-12-propylidene-5,8,11,14-tetrazabicyclo[17.3.1]tricosa-1(23),19,21-triene-6,9-dione;2-methylpropane |
|---|---|
| PubChem CID | 145499039 |
| Molecular Formula | C34H58N4O2 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.46 |
| IUPAC Name | (12E)-13-cyclopropyl-11,16-dimethyl-23-propyl-12-propylidene-5,8,11,14-tetrazabicyclo[17.3.1]tricosa-1(23),19,21-triene-6,9-dione;2-methylpropane |
| SMILES | CC(C)C.CC/C=C1\C(C2CC2)NCC(C)CCc2cccc(c2CCC)CCCNC(=O)CNC(=O)CN1C |
| InChI | InChI=1S/C30H48N4O2.C4H10/c1-5-9-26-23-11-7-12-24(26)15-14-22(3)19-33-30(25-16-17-25)27(10-6-2)34(4)21-29(36)32-20-28(35)31-18-8-13-23;1-4(2)3/h7,10-12,22,25,30,33H,5-6,8-9,13-21H2,1-4H3,(H,31,35)(H,32,36);4H,1-3H3/b27-10+; |
| InChIKey | DCXWRSRBIQWYAR-KQXMRSHDSA-N |
| XLogP | 5.64 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |