C27H43N5O3 — CID 145499074
(7E)-6-cyclopropyl-22-ethyl-8-methyl-7-pentylidene-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione (PubChem CID 145499074) has the molecular formula C27H43N5O3 and a molecular weight of 485.67 g/mol. Its IUPAC name is (7E)-6-cyclopropyl-22-ethyl-8-methyl-7-pentylidene-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione.
| Compound Name | (7E)-6-cyclopropyl-22-ethyl-8-methyl-7-pentylidene-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
|---|---|
| PubChem CID | 145499074 |
| Molecular Formula | C27H43N5O3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | (7E)-6-cyclopropyl-22-ethyl-8-methyl-7-pentylidene-2-oxa-5,8,11,14,19-pentazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
| SMILES | CCCC/C=C1\C(C2CC2)NCCOc2c(CC)ccnc2CCCNC(=O)CNC(=O)CN1C |
| InChI | InChI=1S/C27H43N5O3/c1-4-6-7-10-23-26(21-11-12-21)30-16-17-35-27-20(5-2)13-15-28-22(27)9-8-14-29-24(33)18-31-25(34)19-32(23)3/h10,13,15,21,26,30H,4-9,11-12,14,16-19H2,1-3H3,(H,29,33)(H,31,34)/b23-10+ |
| InChIKey | NACSEXGKKKRGCH-AUEPDCJTSA-N |
| XLogP | 2.58 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|