C26H43N4OP — CID 145499049
(13E)-14-cyclopropyl-12,16-dimethyl-13-propylidene-5,8,12,15-tetraza-9-phosphabicyclo[17.4.0]tricosa-1(23),19,21-trien-6-one (PubChem CID 145499049) has the molecular formula C26H43N4OP and a molecular weight of 458.63 g/mol. Its IUPAC name is (13E)-14-cyclopropyl-12,16-dimethyl-13-propylidene-5,8,12,15-tetraza-9-phosphabicyclo[17.4.0]tricosa-1(23),19,21-trien-6-one.
| Compound Name | (13E)-14-cyclopropyl-12,16-dimethyl-13-propylidene-5,8,12,15-tetraza-9-phosphabicyclo[17.4.0]tricosa-1(23),19,21-trien-6-one |
|---|---|
| PubChem CID | 145499049 |
| Molecular Formula | C26H43N4OP |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (13E)-14-cyclopropyl-12,16-dimethyl-13-propylidene-5,8,12,15-tetraza-9-phosphabicyclo[17.4.0]tricosa-1(23),19,21-trien-6-one |
| SMILES | CC/C=C1\C(C2CC2)NC(C)CCc2ccccc2CCCNC(=O)CNPCCN1C |
| InChI | InChI=1S/C26H43N4OP/c1-4-8-24-26(23-14-15-23)29-20(2)12-13-22-10-6-5-9-21(22)11-7-16-27-25(31)19-28-32-18-17-30(24)3/h5-6,8-10,20,23,26,28-29,32H,4,7,11-19H2,1-3H3,(H,27,31)/b24-8+ |
| InChIKey | BTUAFXJNDDVLPV-KTZMUZOWSA-N |
| XLogP | 3.85 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|