C16H23O7PS — CID 146015122
ethyl 2-(diethoxyphosphorylmethyl)-4-methoxy-7H-thiopyrano[3,4-b]furan-5-carboxylate (PubChem CID 146015122) has the molecular formula C16H23O7PS and a molecular weight of 390.39 g/mol. Its IUPAC name is ethyl 2-(diethoxyphosphorylmethyl)-4-methoxy-7H-thiopyrano[3,4-b]furan-5-carboxylate.
| Compound Name | ethyl 2-(diethoxyphosphorylmethyl)-4-methoxy-7H-thiopyrano[3,4-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 146015122 |
| Molecular Formula | C16H23O7PS |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | ethyl 2-(diethoxyphosphorylmethyl)-4-methoxy-7H-thiopyrano[3,4-b]furan-5-carboxylate |
| SMILES | CCOC(=O)C1=C(OC)c2cc(CP(=O)(OCC)OCC)oc2CS1 |
| InChI | InChI=1S/C16H23O7PS/c1-5-20-16(17)15-14(19-4)12-8-11(23-13(12)10-25-15)9-24(18,21-6-2)22-7-3/h8H,5-7,9-10H2,1-4H3 |
| InChIKey | CCOOCNVNRYKYFX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|