C10H16NO6P — CID 164602395
methyl 5-(diethoxyphosphorylmethyl)-1,3-oxazole-2-carboxylate (PubChem CID 164602395) has the molecular formula C10H16NO6P and a molecular weight of 277.21 g/mol. Its IUPAC name is methyl 5-(diethoxyphosphorylmethyl)-1,3-oxazole-2-carboxylate.
| Compound Name | methyl 5-(diethoxyphosphorylmethyl)-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 164602395 |
| Molecular Formula | C10H16NO6P |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | methyl 5-(diethoxyphosphorylmethyl)-1,3-oxazole-2-carboxylate |
| SMILES | CCOP(=O)(Cc1cnc(C(=O)OC)o1)OCC |
| InChI | InChI=1S/C10H16NO6P/c1-4-15-18(13,16-5-2)7-8-6-11-9(17-8)10(12)14-3/h6H,4-5,7H2,1-3H3 |
| InChIKey | AYIWQQVUCGVTHJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|