C11H13BrF3NO — CID 146026972
1-[(3-bromofuran-2-yl)methyl]-4-(trifluoromethyl)piperidine (PubChem CID 146026972) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 1-[(3-bromofuran-2-yl)methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[(3-bromofuran-2-yl)methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 146026972 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-[(3-bromofuran-2-yl)methyl]-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CCN(Cc2occc2Br)CC1 |
| InChI | InChI=1S/C11H13BrF3NO/c12-9-3-6-17-10(9)7-16-4-1-8(2-5-16)11(13,14)15/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | LKJUWQFNEAZHRA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |