C11H15ClN4O — CID 146027457
N-(diaminomethylidene)-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride (PubChem CID 146027457) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146027457 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(diaminomethylidene)-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride |
| SMILES | CN1c2ccccc2CC1C(=O)N=C(N)N.Cl |
| InChI | InChI=1S/C11H14N4O.ClH/c1-15-8-5-3-2-4-7(8)6-9(15)10(16)14-11(12)13;/h2-5,9H,6H2,1H3,(H4,12,13,14,16);1H |
| InChIKey | FZAVIAIEUFMVBS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|