C17H17IO4 — CID 146031619
(1R,3R,4R,7S)-7-(3,4-dimethoxyphenyl)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 146031619) has the molecular formula C17H17IO4 and a molecular weight of 412.22 g/mol. Its IUPAC name is (1R,3R,4R,7S)-7-(3,4-dimethoxyphenyl)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | (1R,3R,4R,7S)-7-(3,4-dimethoxyphenyl)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 146031619 |
| Molecular Formula | C17H17IO4 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | (1R,3R,4R,7S)-7-(3,4-dimethoxyphenyl)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | COc1ccc([C@H]2C[C@H]3C(I)=C[C@@H]2C(=O)[C@]32CO2)cc1OC |
| InChI | InChI=1S/C17H17IO4/c1-20-14-4-3-9(5-15(14)21-2)10-6-12-13(18)7-11(10)16(19)17(12)8-22-17/h3-5,7,10-12H,6,8H2,1-2H3/t10-,11+,12+,17+/m1/s1 |
| InChIKey | JOLXDFDBNOFRDL-QLQJRFMMSA-N |
| XLogP | 3.09 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|