C17H31N4O7S+ — CID 146037065
(2S)-3-[2-[(2R,3R,4S,5R,6R)-6-[(1R,2R)-1-azaniumyl-2-hydroxypropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanyl-1H-imidazol-5-yl]-2-(trimethylazaniumyl)propanoate (PubChem CID 146037065) has the molecular formula C17H31N4O7S+ and a molecular weight of 435.52 g/mol. Its IUPAC name is (2S)-3-[2-[(2R,3R,4S,5R,6R)-6-[(1R,2R)-1-azaniumyl-2-hydroxypropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanyl-1H-imidazol-5-yl]-2-(trimethylazaniumyl)propanoate.
| Compound Name | (2S)-3-[2-[(2R,3R,4S,5R,6R)-6-[(1R,2R)-1-azaniumyl-2-hydroxypropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanyl-1H-imidazol-5-yl]-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 146037065 |
| Molecular Formula | C17H31N4O7S+ |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (2S)-3-[2-[(2R,3R,4S,5R,6R)-6-[(1R,2R)-1-azaniumyl-2-hydroxypropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanyl-1H-imidazol-5-yl]-2-(trimethylazaniumyl)propanoate |
| SMILES | C[C@@H](O)[C@@H]([NH3+])[C@H]1O[C@H](Sc2ncc(C[C@@H](C(=O)[O-])[N+](C)(C)C)[nH]2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H30N4O7S/c1-7(22)10(18)14-12(24)11(23)13(25)16(28-14)29-17-19-6-8(20-17)5-9(15(26)27)21(2,3)4/h6-7,9-14,16,22-25H,5,18H2,1-4H3,(H-,19,20,26,27)/p+1/t7-,9+,10-,11+,12-,13-,14-,16-/m1/s1 |
| InChIKey | MZDFOQLXMBUKGA-KSZMXYAJSA-O |
| XLogP | -4.33 |
| TPSA | 186.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|