C10H17N3O2S — CID 175597376
3-[(2S)-2-methanethioyl-2,3-dihydro-1H-imidazol-4-yl]-2-(trimethylazaniumyl)propanoate (PubChem CID 175597376) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[(2S)-2-methanethioyl-2,3-dihydro-1H-imidazol-4-yl]-2-(trimethylazaniumyl)propanoate.
| Compound Name | 3-[(2S)-2-methanethioyl-2,3-dihydro-1H-imidazol-4-yl]-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 175597376 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-[(2S)-2-methanethioyl-2,3-dihydro-1H-imidazol-4-yl]-2-(trimethylazaniumyl)propanoate |
| SMILES | C[N+](C)(C)C(CC1=CN[C@H](C=S)N1)C(=O)[O-] |
| InChI | InChI=1S/C10H17N3O2S/c1-13(2,3)8(10(14)15)4-7-5-11-9(6-16)12-7/h5-6,8-9,11-12H,4H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | OMPJXDOSLCDHFA-GKAPJAKFSA-N |
| XLogP | -1.44 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|