C15H23NO5 — CID 162812058
(2R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-(trimethylazaniumyl)butanoate (PubChem CID 162812058) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-(trimethylazaniumyl)butanoate.
| Compound Name | (2R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 162812058 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-(trimethylazaniumyl)butanoate |
| SMILES | COc1cc(CC[C@H](C(=O)[O-])[N+](C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C15H23NO5/c1-16(2,3)11(15(18)19)7-6-10-8-12(20-4)14(17)13(9-10)21-5/h8-9,11H,6-7H2,1-5H3,(H-,17,18,19)/t11-/m1/s1 |
| InChIKey | CQAXHXITAVOZSM-LLVKDONJSA-N |
| XLogP | 0.17 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|