C10H16N2O2S — CID 58542492
(2S)-3-(2-sulfanylidene-1,3-dihydropyrrol-4-yl)-2-(trimethylazaniumyl)propanoate (PubChem CID 58542492) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is (2S)-3-(2-sulfanylidene-1,3-dihydropyrrol-4-yl)-2-(trimethylazaniumyl)propanoate.
| Compound Name | (2S)-3-(2-sulfanylidene-1,3-dihydropyrrol-4-yl)-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 58542492 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (2S)-3-(2-sulfanylidene-1,3-dihydropyrrol-4-yl)-2-(trimethylazaniumyl)propanoate |
| SMILES | C[N+](C)(C)[C@@H](CC1=CNC(=S)C1)C(=O)[O-] |
| InChI | InChI=1S/C10H16N2O2S/c1-12(2,3)8(10(13)14)4-7-5-9(15)11-6-7/h6,8H,4-5H2,1-3H3,(H-,11,13,14,15)/t8-/m0/s1 |
| InChIKey | RSDOFBFMMZXYHV-QMMMGPOBSA-N |
| XLogP | -0.59 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|