C23H32F2N2O3 — CID 146045034
ethyl (4aR,6R,8aS)-2-[(2,3-difluorophenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate (PubChem CID 146045034) has the molecular formula C23H32F2N2O3 and a molecular weight of 422.52 g/mol. Its IUPAC name is ethyl (4aR,6R,8aS)-2-[(2,3-difluorophenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate.
| Compound Name | ethyl (4aR,6R,8aS)-2-[(2,3-difluorophenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 146045034 |
| Molecular Formula | C23H32F2N2O3 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | ethyl (4aR,6R,8aS)-2-[(2,3-difluorophenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(Cc1cccc(F)c1F)C2 |
| InChI | InChI=1S/C23H32F2N2O3/c1-2-30-22(28)23-8-6-19(27-10-12-29-13-11-27)14-18(23)7-9-26(16-23)15-17-4-3-5-20(24)21(17)25/h3-5,18-19H,2,6-16H2,1H3/t18-,19-,23-/m1/s1 |
| InChIKey | CQSGTQFCSRSEMN-DNVFCKCGSA-N |
| XLogP | 3.22 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |