C23H33FN2O2 — CID 90676720
methyl 4-[(5R,6R,9S,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 90676720) has the molecular formula C23H33FN2O2 and a molecular weight of 388.53 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9S,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9S,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 90676720 |
| Molecular Formula | C23H33FN2O2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | methyl 4-[(5R,6R,9S,13S)-7-[(4-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1ccc(F)cc1)[C@@H]23 |
| InChI | InChI=1S/C23H33FN2O2/c1-28-22(27)8-2-7-21-20-6-4-14-25-13-3-5-18(23(20)25)16-26(21)15-17-9-11-19(24)12-10-17/h9-12,18,20-21,23H,2-8,13-16H2,1H3/t18-,20+,21+,23-/m0/s1 |
| InChIKey | OTMDYMLQYNGBIM-NQAVQENRSA-N |
| XLogP | 3.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |