C19H35N3O3S — CID 146092493
tert-butyl N-[(2S,3R)-2-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]oxolan-3-yl]carbamate (PubChem CID 146092493) has the molecular formula C19H35N3O3S and a molecular weight of 385.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]oxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-2-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 146092493 |
| Molecular Formula | C19H35N3O3S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]oxolan-3-yl]carbamate |
| SMILES | CC(C)CNC(=S)N1CCC([C@@H]2OCC[C@H]2NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H35N3O3S/c1-13(2)12-20-17(26)22-9-6-14(7-10-22)16-15(8-11-24-16)21-18(23)25-19(3,4)5/h13-16H,6-12H2,1-5H3,(H,20,26)(H,21,23)/t15-,16+/m1/s1 |
| InChIKey | WBZBBOQDWGGGLZ-CVEARBPZSA-N |
| XLogP | 2.91 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|