C22H24N4O — CID 146093993
[2-(cyclobutylamino)-4-pyridinyl]-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indol-2-yl)methanone (PubChem CID 146093993) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-(cyclobutylamino)-4-pyridinyl]-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indol-2-yl)methanone.
| Compound Name | [2-(cyclobutylamino)-4-pyridinyl]-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indol-2-yl)methanone |
|---|---|
| PubChem CID | 146093993 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [2-(cyclobutylamino)-4-pyridinyl]-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indol-2-yl)methanone |
| SMILES | O=C(c1ccnc(NC2CCC2)c1)N1CCCn2c(cc3ccccc32)C1 |
| InChI | InChI=1S/C22H24N4O/c27-22(17-9-10-23-21(14-17)24-18-6-3-7-18)25-11-4-12-26-19(15-25)13-16-5-1-2-8-20(16)26/h1-2,5,8-10,13-14,18H,3-4,6-7,11-12,15H2,(H,23,24) |
| InChIKey | VKFYQVFEMOSYPJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |