About 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine
4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 146095329) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine.
Analyze 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine?
The IUPAC name of 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine (CID 146095329) is 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine.
What is the SMILES notation for 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine?
The canonical SMILES for 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine is Nc1ncc2c(n1)CC1CCCC2N1.
What is the InChIKey of 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine?
The InChIKey is BXHZRYWAXDRALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c11-10-12-5-7-8-3-1-2-6(13-8)4-9(7)14-10/h5-6,8,13H,1-4H2,(H2,11,12,14).
What are the key properties of 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine?
4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine has a molecular weight of 190.25 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-5-amine is sourced from PubChem (CID 146095329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).