About N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide
N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide (PubChem CID 146098808) has the molecular formula C18H17F2N5O2S
and a molecular weight of 405.43 g/mol. Its IUPAC name is N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide |
| PubChem CID | 146098808 |
| Molecular Formula | C18H17F2N5O2S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(Cn2nnnc2Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2N5O2S/c19-14-4-3-13(17(20)10-14)9-18-21-23-24-25(18)11-12-1-7-16(8-2-12)28(26,27)22-15-5-6-15/h1-4,7-8,10,15,22H,5-6,9,11H2 |
| InChIKey | IRKRLOWJMUJHFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide?
The IUPAC name of N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide (CID 146098808) is N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide.
What is the SMILES notation for N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide?
The canonical SMILES for N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide is O=S(=O)(NC1CC1)c1ccc(Cn2nnnc2Cc2ccc(F)cc2F)cc1.
What is the InChIKey of N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide?
The InChIKey is IRKRLOWJMUJHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2N5O2S/c19-14-4-3-13(17(20)10-14)9-18-21-23-24-25(18)11-12-1-7-16(8-2-12)28(26,27)22-15-5-6-15/h1-4,7-8,10,15,22H,5-6,9,11H2.
What are the key properties of N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide?
N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide has a molecular weight of 405.43 g/mol, XLogP of 2.03, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4-[[5-[(2,4-difluorophenyl)methyl]tetrazol-1-yl]methyl]benzenesulfonamide is sourced from PubChem (CID 146098808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).