C17H15ClF3N3O4S — CID 146101509
6-chloro-2-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyridine-3-sulfonamide (PubChem CID 146101509) has the molecular formula C17H15ClF3N3O4S and a molecular weight of 449.84 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-2-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 146101509 |
| Molecular Formula | C17H15ClF3N3O4S |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 6-chloro-2-methyl-N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]pyridine-3-sulfonamide |
| SMILES | Cc1nc(Cl)ccc1S(=O)(=O)NC1CCN(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H15ClF3N3O4S/c1-10-14(5-6-15(18)22-10)29(26,27)23-13-7-8-24(16(13)25)11-3-2-4-12(9-11)28-17(19,20)21/h2-6,9,13,23H,7-8H2,1H3 |
| InChIKey | PZNXGRLBODDLPH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|