C11H17NO4 — CID 146104750
N-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]but-2-ynamide (PubChem CID 146104750) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]but-2-ynamide.
| Compound Name | N-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]but-2-ynamide |
|---|---|
| PubChem CID | 146104750 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCC(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H17NO4/c1-4-5-10(14)12-6-8(13)9-7-15-11(2,3)16-9/h8-9,13H,6-7H2,1-3H3,(H,12,14)/t8?,9-/m1/s1 |
| InChIKey | PBVAUPLCWOZSMB-YGPZHTELSA-N |
| XLogP | -0.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|