C15H22N4O4S — CID 146111499
[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)azetidin-1-yl]methanone (PubChem CID 146111499) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)azetidin-1-yl]methanone.
| Compound Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 146111499 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)azetidin-1-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CC(N4CCCS4(=O)=O)C3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C15H22N4O4S/c1-9-6-12-13(10(2)23-9)16-17-14(12)15(20)18-7-11(8-18)19-4-3-5-24(19,21)22/h9-11H,3-8H2,1-2H3,(H,16,17)/t9-,10+/m1/s1 |
| InChIKey | IFFHGPPSKUZNKZ-ZJUUUORDSA-N |
| XLogP | 0.29 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |