C18H29N7O — CID 146115726
6-[(2S,4S)-2-[(dimethylamino)methyl]-4-methoxypyrrolidin-1-yl]-N-(3-imidazol-1-ylpropyl)pyrimidin-4-amine (PubChem CID 146115726) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is 6-[(2S,4S)-2-[(dimethylamino)methyl]-4-methoxypyrrolidin-1-yl]-N-(3-imidazol-1-ylpropyl)pyrimidin-4-amine.
| Compound Name | 6-[(2S,4S)-2-[(dimethylamino)methyl]-4-methoxypyrrolidin-1-yl]-N-(3-imidazol-1-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 146115726 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 6-[(2S,4S)-2-[(dimethylamino)methyl]-4-methoxypyrrolidin-1-yl]-N-(3-imidazol-1-ylpropyl)pyrimidin-4-amine |
| SMILES | CO[C@H]1C[C@@H](CN(C)C)N(c2cc(NCCCn3ccnc3)ncn2)C1 |
| InChI | InChI=1S/C18H29N7O/c1-23(2)11-15-9-16(26-3)12-25(15)18-10-17(21-13-22-18)20-5-4-7-24-8-6-19-14-24/h6,8,10,13-16H,4-5,7,9,11-12H2,1-3H3,(H,20,21,22)/t15-,16-/m0/s1 |
| InChIKey | ZOTYGBMKVOHFFT-HOTGVXAUSA-N |
| XLogP | 1.33 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|