C12H21N3O3 — CID 146119857
(3S,3aS,6aS)-3-methoxy-1-methyl-2-oxo-N-propan-2-yl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119857) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-methoxy-1-methyl-2-oxo-N-propan-2-yl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-3-methoxy-1-methyl-2-oxo-N-propan-2-yl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119857 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (3S,3aS,6aS)-3-methoxy-1-methyl-2-oxo-N-propan-2-yl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | CO[C@@H]1C(=O)N(C)[C@@H]2CN(C(=O)NC(C)C)C[C@H]12 |
| InChI | InChI=1S/C12H21N3O3/c1-7(2)13-12(17)15-5-8-9(6-15)14(3)11(16)10(8)18-4/h7-10H,5-6H2,1-4H3,(H,13,17)/t8-,9+,10-/m0/s1 |
| InChIKey | QMUYOINSSUDLFE-AEJSXWLSSA-N |
| XLogP | -0.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |