C12H18N2O5S — CID 146123707
N-(4-ethyloxan-4-yl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 146123707) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(4-ethyloxan-4-yl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(4-ethyloxan-4-yl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 146123707 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(4-ethyloxan-4-yl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | CCC1(NC(=O)c2ccc(S(N)(=O)=O)o2)CCOCC1 |
| InChI | InChI=1S/C12H18N2O5S/c1-2-12(5-7-18-8-6-12)14-11(15)9-3-4-10(19-9)20(13,16)17/h3-4H,2,5-8H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | NCJLJCODJVCYDW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |